C13H18O4S2 — CID 54460531
3-butanoyl-1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione (PubChem CID 54460531) has the molecular formula C13H18O4S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 3-butanoyl-1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione.
| Compound Name | 3-butanoyl-1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione |
|---|---|
| PubChem CID | 54460531 |
| Molecular Formula | C13H18O4S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 3-butanoyl-1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione |
| SMILES | CCCC(=O)C1C(=O)CC2(CSCCSC2)OC1=O |
| InChI | InChI=1S/C13H18O4S2/c1-2-3-9(14)11-10(15)6-13(17-12(11)16)7-18-4-5-19-8-13/h11H,2-8H2,1H3 |
| InChIKey | XBHNLERBRJBECW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|