C26H36N2O7S — CID 54142531
N-[(3S)-1-(furan-2-ylmethylsulfonyl)-2-oxoheptan-3-yl]-5-[[2-(4-methylphenoxy)acetyl]amino]pentanamide (PubChem CID 54142531) has the molecular formula C26H36N2O7S and a molecular weight of 520.65 g/mol. Its IUPAC name is N-[(3S)-1-(furan-2-ylmethylsulfonyl)-2-oxoheptan-3-yl]-5-[[2-(4-methylphenoxy)acetyl]amino]pentanamide.
| Compound Name | N-[(3S)-1-(furan-2-ylmethylsulfonyl)-2-oxoheptan-3-yl]-5-[[2-(4-methylphenoxy)acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 54142531 |
| Molecular Formula | C26H36N2O7S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | N-[(3S)-1-(furan-2-ylmethylsulfonyl)-2-oxoheptan-3-yl]-5-[[2-(4-methylphenoxy)acetyl]amino]pentanamide |
| SMILES | CCCC[C@H](NC(=O)CCCCNC(=O)COc1ccc(C)cc1)C(=O)CS(=O)(=O)Cc1ccco1 |
| InChI | InChI=1S/C26H36N2O7S/c1-3-4-9-23(24(29)19-36(32,33)18-22-8-7-16-34-22)28-25(30)10-5-6-15-27-26(31)17-35-21-13-11-20(2)12-14-21/h7-8,11-14,16,23H,3-6,9-10,15,17-19H2,1-2H3,(H,27,31)(H,28,30)/t23-/m0/s1 |
| InChIKey | OCBOYCHDSOWJPE-QHCPKHFHSA-N |
| XLogP | 3.11 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|