C26H38N2O6S — CID 70051105
N-[5-[[1-(furan-2-ylmethylsulfonyl)-2-oxoheptan-3-yl]amino]pentan-2-yl]-N-methyl-2-phenoxyacetamide (PubChem CID 70051105) has the molecular formula C26H38N2O6S and a molecular weight of 506.67 g/mol. Its IUPAC name is N-[5-[[1-(furan-2-ylmethylsulfonyl)-2-oxoheptan-3-yl]amino]pentan-2-yl]-N-methyl-2-phenoxyacetamide.
| Compound Name | N-[5-[[1-(furan-2-ylmethylsulfonyl)-2-oxoheptan-3-yl]amino]pentan-2-yl]-N-methyl-2-phenoxyacetamide |
|---|---|
| PubChem CID | 70051105 |
| Molecular Formula | C26H38N2O6S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | N-[5-[[1-(furan-2-ylmethylsulfonyl)-2-oxoheptan-3-yl]amino]pentan-2-yl]-N-methyl-2-phenoxyacetamide |
| SMILES | CCCCC(NCCCC(C)N(C)C(=O)COc1ccccc1)C(=O)CS(=O)(=O)Cc1ccco1 |
| InChI | InChI=1S/C26H38N2O6S/c1-4-5-15-24(25(29)20-35(31,32)19-23-14-10-17-33-23)27-16-9-11-21(2)28(3)26(30)18-34-22-12-7-6-8-13-22/h6-8,10,12-14,17,21,24,27H,4-5,9,11,15-16,18-20H2,1-3H3 |
| InChIKey | MBKIRJNIFQBACI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|