C29H42N2O4S — CID 70051706
N-[5-[[1-cyclohexyl-4-(furan-2-ylmethylsulfanyl)-3-oxobutan-2-yl]amino]pentan-2-yl]-N-methyl-2-phenoxyacetamide (PubChem CID 70051706) has the molecular formula C29H42N2O4S and a molecular weight of 514.73 g/mol. Its IUPAC name is N-[5-[[1-cyclohexyl-4-(furan-2-ylmethylsulfanyl)-3-oxobutan-2-yl]amino]pentan-2-yl]-N-methyl-2-phenoxyacetamide.
| Compound Name | N-[5-[[1-cyclohexyl-4-(furan-2-ylmethylsulfanyl)-3-oxobutan-2-yl]amino]pentan-2-yl]-N-methyl-2-phenoxyacetamide |
|---|---|
| PubChem CID | 70051706 |
| Molecular Formula | C29H42N2O4S |
| Molecular Weight | 514.73 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | N-[5-[[1-cyclohexyl-4-(furan-2-ylmethylsulfanyl)-3-oxobutan-2-yl]amino]pentan-2-yl]-N-methyl-2-phenoxyacetamide |
| SMILES | CC(CCCNC(CC1CCCCC1)C(=O)CSCc1ccco1)N(C)C(=O)COc1ccccc1 |
| InChI | InChI=1S/C29H42N2O4S/c1-23(31(2)29(33)20-35-25-14-7-4-8-15-25)11-9-17-30-27(19-24-12-5-3-6-13-24)28(32)22-36-21-26-16-10-18-34-26/h4,7-8,10,14-16,18,23-24,27,30H,3,5-6,9,11-13,17,19-22H2,1-2H3 |
| InChIKey | LBQAKNLPEZVBRJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.73 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|