C26H38N2O3S — CID 70052597
N-[5-[[1-(furan-2-ylmethylsulfanyl)-2-oxoheptan-3-yl]amino]pentan-2-yl]-N-methyl-2-phenylacetamide (PubChem CID 70052597) has the molecular formula C26H38N2O3S and a molecular weight of 458.67 g/mol. Its IUPAC name is N-[5-[[1-(furan-2-ylmethylsulfanyl)-2-oxoheptan-3-yl]amino]pentan-2-yl]-N-methyl-2-phenylacetamide.
| Compound Name | N-[5-[[1-(furan-2-ylmethylsulfanyl)-2-oxoheptan-3-yl]amino]pentan-2-yl]-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 70052597 |
| Molecular Formula | C26H38N2O3S |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | N-[5-[[1-(furan-2-ylmethylsulfanyl)-2-oxoheptan-3-yl]amino]pentan-2-yl]-N-methyl-2-phenylacetamide |
| SMILES | CCCCC(NCCCC(C)N(C)C(=O)Cc1ccccc1)C(=O)CSCc1ccco1 |
| InChI | InChI=1S/C26H38N2O3S/c1-4-5-15-24(25(29)20-32-19-23-14-10-17-31-23)27-16-9-11-21(2)28(3)26(30)18-22-12-7-6-8-13-22/h6-8,10,12-14,17,21,24,27H,4-5,9,11,15-16,18-20H2,1-3H3 |
| InChIKey | XHTLQINDSRYQJP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|