methyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate

C12H14N2O2 — CID 54142588

IUPACmethyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate
SMILESCOC(=O)C1(Cc2ccccc2)CN=CN1
InChIInChI=1S/C12H14N2O2/c1-16-11(15)12(8-13-9-14-12)7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,13,14)
InChIKeyOCCQYEVMULIVES-UHFFFAOYSA-N
MW218.26 g/mol
LogP0.77
Rot. Bonds3

About methyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate

methyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate (PubChem CID 54142588) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is methyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate.

Molecular Properties

Compound Namemethyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate
PubChem CID54142588
Molecular FormulaC12H14N2O2
Molecular Weight218.26 g/mol
Exact Mass218.11
IUPAC Namemethyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate
SMILESCOC(=O)C1(Cc2ccccc2)CN=CN1
InChIInChI=1S/C12H14N2O2/c1-16-11(15)12(8-13-9-14-12)7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,13,14)
InChIKeyOCCQYEVMULIVES-UHFFFAOYSA-N
XLogP0.77
TPSA50.69 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.26
LogP ≤ 50.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate?
The IUPAC name of methyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate (CID 54142588) is methyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate.
What is the SMILES notation for methyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate?
The canonical SMILES for methyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate is COC(=O)C1(Cc2ccccc2)CN=CN1.
What is the InChIKey of methyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate?
The InChIKey is OCCQYEVMULIVES-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c1-16-11(15)12(8-13-9-14-12)7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,13,14).
What are the key properties of methyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate?
methyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate has a molecular weight of 218.26 g/mol, XLogP of 0.77, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate is sourced from PubChem (CID 54142588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).