C12H14N2O2 — CID 54142588
methyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate (PubChem CID 54142588) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is methyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate.
| Compound Name | methyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate |
|---|---|
| PubChem CID | 54142588 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | methyl 5-benzyl-1,4-dihydroimidazole-5-carboxylate |
| SMILES | COC(=O)C1(Cc2ccccc2)CN=CN1 |
| InChI | InChI=1S/C12H14N2O2/c1-16-11(15)12(8-13-9-14-12)7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,13,14) |
| InChIKey | OCCQYEVMULIVES-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |