About O-(2-hydroxyphenyl) N-(2-fluorophenyl)carbamothioate
O-(2-hydroxyphenyl) N-(2-fluorophenyl)carbamothioate (PubChem CID 54147390) has the molecular formula C13H10FNO2S
and a molecular weight of 263.29 g/mol. Its IUPAC name is O-(2-hydroxyphenyl) N-(2-fluorophenyl)carbamothioate.
Molecular Properties
| Compound Name | O-(2-hydroxyphenyl) N-(2-fluorophenyl)carbamothioate |
| PubChem CID | 54147390 |
| Molecular Formula | C13H10FNO2S |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | O-(2-hydroxyphenyl) N-(2-fluorophenyl)carbamothioate |
| SMILES | Oc1ccccc1OC(=S)Nc1ccccc1F |
| InChI | InChI=1S/C13H10FNO2S/c14-9-5-1-2-6-10(9)15-13(18)17-12-8-4-3-7-11(12)16/h1-8,16H,(H,15,18) |
| InChIKey | OFIUKSNOEVBBBY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(2-hydroxyphenyl) N-(2-fluorophenyl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(2-hydroxyphenyl) N-(2-fluorophenyl)carbamothioate?
The IUPAC name of O-(2-hydroxyphenyl) N-(2-fluorophenyl)carbamothioate (CID 54147390) is O-(2-hydroxyphenyl) N-(2-fluorophenyl)carbamothioate.
What is the SMILES notation for O-(2-hydroxyphenyl) N-(2-fluorophenyl)carbamothioate?
The canonical SMILES for O-(2-hydroxyphenyl) N-(2-fluorophenyl)carbamothioate is Oc1ccccc1OC(=S)Nc1ccccc1F.
What is the InChIKey of O-(2-hydroxyphenyl) N-(2-fluorophenyl)carbamothioate?
The InChIKey is OFIUKSNOEVBBBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10FNO2S/c14-9-5-1-2-6-10(9)15-13(18)17-12-8-4-3-7-11(12)16/h1-8,16H,(H,15,18).
What are the key properties of O-(2-hydroxyphenyl) N-(2-fluorophenyl)carbamothioate?
O-(2-hydroxyphenyl) N-(2-fluorophenyl)carbamothioate has a molecular weight of 263.29 g/mol, XLogP of 3.31, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-(2-hydroxyphenyl) N-(2-fluorophenyl)carbamothioate is sourced from PubChem (CID 54147390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).