C19H20N4O4 — CID 54148452
5-[(2-cyano-1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-5-yl)methyl]-1,3-dihydroxy-4,5,6,7-tetrahydroisoindole-2-carbonitrile (PubChem CID 54148452) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 5-[(2-cyano-1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-5-yl)methyl]-1,3-dihydroxy-4,5,6,7-tetrahydroisoindole-2-carbonitrile.
| Compound Name | 5-[(2-cyano-1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-5-yl)methyl]-1,3-dihydroxy-4,5,6,7-tetrahydroisoindole-2-carbonitrile |
|---|---|
| PubChem CID | 54148452 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 5-[(2-cyano-1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-5-yl)methyl]-1,3-dihydroxy-4,5,6,7-tetrahydroisoindole-2-carbonitrile |
| SMILES | N#Cn1c(O)c2c(c1O)CC(CC1CCc3c(c(O)n(C#N)c3O)C1)CC2 |
| InChI | InChI=1S/C19H20N4O4/c20-8-22-16(24)12-3-1-10(6-14(12)18(22)26)5-11-2-4-13-15(7-11)19(27)23(9-21)17(13)25/h10-11,24-27H,1-7H2 |
| InChIKey | OGALSWVTCMOWRL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 138.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |