C14H14N2O8 — CID 54465879
2,6-bis(hydroxymethyl)-4,8-bis(hydroxymethylidene)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrol (PubChem CID 54465879) has the molecular formula C14H14N2O8 and a molecular weight of 338.27 g/mol. Its IUPAC name is 2,6-bis(hydroxymethyl)-4,8-bis(hydroxymethylidene)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrol.
| Compound Name | 2,6-bis(hydroxymethyl)-4,8-bis(hydroxymethylidene)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrol |
|---|---|
| PubChem CID | 54465879 |
| Molecular Formula | C14H14N2O8 |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 2,6-bis(hydroxymethyl)-4,8-bis(hydroxymethylidene)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrol |
| SMILES | OC=c1c2c(O)n(CO)c(O)c2c(=CO)c2c(O)n(CO)c(O)c12 |
| InChI | InChI=1S/C14H14N2O8/c17-1-5-7-9(13(23)15(3-19)11(7)21)6(2-18)10-8(5)12(22)16(4-20)14(10)24/h1-2,17-24H,3-4H2/b5-1-,6-2+ |
| InChIKey | XEUUFGVDYDPMGY-SOSXVSKCSA-N |
| XLogP | -1.09 |
| TPSA | 171.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |