C14H12Br2N2O6 — CID 54270582
2,6-bis(bromomethyl)-4,8-bis(hydroxymethylidene)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrol (PubChem CID 54270582) has the molecular formula C14H12Br2N2O6 and a molecular weight of 464.07 g/mol. Its IUPAC name is 2,6-bis(bromomethyl)-4,8-bis(hydroxymethylidene)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrol.
| Compound Name | 2,6-bis(bromomethyl)-4,8-bis(hydroxymethylidene)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrol |
|---|---|
| PubChem CID | 54270582 |
| Molecular Formula | C14H12Br2N2O6 |
| Molecular Weight | 464.07 g/mol |
| Exact Mass | 461.91 |
| IUPAC Name | 2,6-bis(bromomethyl)-4,8-bis(hydroxymethylidene)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrol |
| SMILES | OC=c1c2c(O)n(CBr)c(O)c2c(=CO)c2c(O)n(CBr)c(O)c12 |
| InChI | InChI=1S/C14H12Br2N2O6/c15-3-17-11(21)7-5(1-19)8-10(6(2-20)9(7)13(17)23)14(24)18(4-16)12(8)22/h1-2,19-24H,3-4H2/b5-1-,6-2+ |
| InChIKey | RJUXWXFUNVDSJQ-SOSXVSKCSA-N |
| XLogP | 1.72 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.07 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|