C27H42N2O5S2Si — CID 54148679
(5R)-18-[tert-butyl(dimethyl)silyl]oxy-16-methoxy-15-methyl-7,13-dioxo-N-prop-2-enyl-12-oxa-3-thia-6-azabicyclo[12.4.0]octadeca-1(18),14,16-triene-5-carbothioamide (PubChem CID 54148679) has the molecular formula C27H42N2O5S2Si and a molecular weight of 566.86 g/mol. Its IUPAC name is (5R)-18-[tert-butyl(dimethyl)silyl]oxy-16-methoxy-15-methyl-7,13-dioxo-N-prop-2-enyl-12-oxa-3-thia-6-azabicyclo[12.4.0]octadeca-1(18),14,16-triene-5-carbothioamide.
| Compound Name | (5R)-18-[tert-butyl(dimethyl)silyl]oxy-16-methoxy-15-methyl-7,13-dioxo-N-prop-2-enyl-12-oxa-3-thia-6-azabicyclo[12.4.0]octadeca-1(18),14,16-triene-5-carbothioamide |
|---|---|
| PubChem CID | 54148679 |
| Molecular Formula | C27H42N2O5S2Si |
| Molecular Weight | 566.86 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | (5R)-18-[tert-butyl(dimethyl)silyl]oxy-16-methoxy-15-methyl-7,13-dioxo-N-prop-2-enyl-12-oxa-3-thia-6-azabicyclo[12.4.0]octadeca-1(18),14,16-triene-5-carbothioamide |
| SMILES | C=CCNC(=S)[C@H]1CSCc2c(O[Si](C)(C)C(C)(C)C)cc(OC)c(C)c2C(=O)OCCCCC(=O)N1 |
| InChI | InChI=1S/C27H42N2O5S2Si/c1-9-13-28-25(35)20-17-36-16-19-22(34-37(7,8)27(3,4)5)15-21(32-6)18(2)24(19)26(31)33-14-11-10-12-23(30)29-20/h9,15,20H,1,10-14,16-17H2,2-8H3,(H,28,35)(H,29,30)/t20-/m1/s1 |
| InChIKey | OGEPIQQTVADWQF-HXUWFJFHSA-N |
| XLogP | 5.55 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.86 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|