C12H12BrNO4 — CID 54150246
ethyl 2-[(5-bromo-4-methyl-3-oxocyclohepta-1,4,6-trien-1-yl)amino]-2-oxoacetate (PubChem CID 54150246) has the molecular formula C12H12BrNO4 and a molecular weight of 314.14 g/mol. Its IUPAC name is ethyl 2-[(5-bromo-4-methyl-3-oxocyclohepta-1,4,6-trien-1-yl)amino]-2-oxoacetate.
| Compound Name | ethyl 2-[(5-bromo-4-methyl-3-oxocyclohepta-1,4,6-trien-1-yl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 54150246 |
| Molecular Formula | C12H12BrNO4 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | ethyl 2-[(5-bromo-4-methyl-3-oxocyclohepta-1,4,6-trien-1-yl)amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1ccc(Br)c(C)c(=O)c1 |
| InChI | InChI=1S/C12H12BrNO4/c1-3-18-12(17)11(16)14-8-4-5-9(13)7(2)10(15)6-8/h4-6H,3H2,1-2H3,(H,14,16) |
| InChIKey | OHFLDGZGJBVTGT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|