C15H26F3NO4 — CID 54153688
6,6,6-trifluoro-2-(2-methylpropyl)-3-(oxan-2-yloxyamino)hexanoic acid (PubChem CID 54153688) has the molecular formula C15H26F3NO4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 6,6,6-trifluoro-2-(2-methylpropyl)-3-(oxan-2-yloxyamino)hexanoic acid.
| Compound Name | 6,6,6-trifluoro-2-(2-methylpropyl)-3-(oxan-2-yloxyamino)hexanoic acid |
|---|---|
| PubChem CID | 54153688 |
| Molecular Formula | C15H26F3NO4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 6,6,6-trifluoro-2-(2-methylpropyl)-3-(oxan-2-yloxyamino)hexanoic acid |
| SMILES | CC(C)CC(C(=O)O)C(CCC(F)(F)F)NOC1CCCCO1 |
| InChI | InChI=1S/C15H26F3NO4/c1-10(2)9-11(14(20)21)12(6-7-15(16,17)18)19-23-13-5-3-4-8-22-13/h10-13,19H,3-9H2,1-2H3,(H,20,21) |
| InChIKey | OJNOIXTZVNJNFV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|