C11H19N — CID 54154861
10-methyl-8-azatricyclo[6.2.1.02,6]undecane (PubChem CID 54154861) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 10-methyl-8-azatricyclo[6.2.1.02,6]undecane.
| Compound Name | 10-methyl-8-azatricyclo[6.2.1.02,6]undecane |
|---|---|
| PubChem CID | 54154861 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 10-methyl-8-azatricyclo[6.2.1.02,6]undecane |
| SMILES | CC1CN2CC3CCCC3C1C2 |
| InChI | InChI=1S/C11H19N/c1-8-5-12-6-9-3-2-4-10(9)11(8)7-12/h8-11H,2-7H2,1H3 |
| InChIKey | OKHXNTMLJQTEED-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |