C12H21N — CID 170009197
(3aR,7aS)-1,2-dimethyl-1,3,3a,3b,4,5,6,6a,7,7a-decahydropentaleno[1,2-c]pyrrole (PubChem CID 170009197) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (3aR,7aS)-1,2-dimethyl-1,3,3a,3b,4,5,6,6a,7,7a-decahydropentaleno[1,2-c]pyrrole.
| Compound Name | (3aR,7aS)-1,2-dimethyl-1,3,3a,3b,4,5,6,6a,7,7a-decahydropentaleno[1,2-c]pyrrole |
|---|---|
| PubChem CID | 170009197 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (3aR,7aS)-1,2-dimethyl-1,3,3a,3b,4,5,6,6a,7,7a-decahydropentaleno[1,2-c]pyrrole |
| SMILES | CC1[C@H]2CC3CCCC3[C@H]2CN1C |
| InChI | InChI=1S/C12H21N/c1-8-11-6-9-4-3-5-10(9)12(11)7-13(8)2/h8-12H,3-7H2,1-2H3/t8?,9?,10?,11-,12-/m1/s1 |
| InChIKey | NUTPVUACWPEUHL-XWBCYODSSA-N |
| XLogP | 2.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |