C10H15NO3 — CID 54155419
6-(2,5-dihydroxypyrrol-1-yl)hexanal (PubChem CID 54155419) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 6-(2,5-dihydroxypyrrol-1-yl)hexanal.
| Compound Name | 6-(2,5-dihydroxypyrrol-1-yl)hexanal |
|---|---|
| PubChem CID | 54155419 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 6-(2,5-dihydroxypyrrol-1-yl)hexanal |
| SMILES | O=CCCCCCn1c(O)ccc1O |
| InChI | InChI=1S/C10H15NO3/c12-8-4-2-1-3-7-11-9(13)5-6-10(11)14/h5-6,8,13-14H,1-4,7H2 |
| InChIKey | BNLPOBWEICWGPV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|