C10H15N5O4 — CID 54155957
(2S)-2-[(4-amino-1-methyl-5-nitroso-6-oxopyrimidin-2-yl)amino]-3-methylbutanoic acid (PubChem CID 54155957) has the molecular formula C10H15N5O4 and a molecular weight of 269.26 g/mol. Its IUPAC name is (2S)-2-[(4-amino-1-methyl-5-nitroso-6-oxopyrimidin-2-yl)amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[(4-amino-1-methyl-5-nitroso-6-oxopyrimidin-2-yl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 54155957 |
| Molecular Formula | C10H15N5O4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (2S)-2-[(4-amino-1-methyl-5-nitroso-6-oxopyrimidin-2-yl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(Nc1nc(N)c(N=O)c(=O)n1C)C(=O)O |
| InChI | InChI=1S/C10H15N5O4/c1-4(2)5(9(17)18)12-10-13-7(11)6(14-19)8(16)15(10)3/h4-5H,11H2,1-3H3,(H,12,13)(H,17,18) |
| InChIKey | OLBGPGOUDPZBLM-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |