C29H41FN4O7 — CID 54156801
(5S,12R)-N-[3-(5-fluoro-2,4-dinitroanilino)propyl]-5,12-dihydroxyicosa-6,8,10,14-tetraenamide (PubChem CID 54156801) has the molecular formula C29H41FN4O7 and a molecular weight of 576.67 g/mol. Its IUPAC name is (5S,12R)-N-[3-(5-fluoro-2,4-dinitroanilino)propyl]-5,12-dihydroxyicosa-6,8,10,14-tetraenamide.
| Compound Name | (5S,12R)-N-[3-(5-fluoro-2,4-dinitroanilino)propyl]-5,12-dihydroxyicosa-6,8,10,14-tetraenamide |
|---|---|
| PubChem CID | 54156801 |
| Molecular Formula | C29H41FN4O7 |
| Molecular Weight | 576.67 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | (5S,12R)-N-[3-(5-fluoro-2,4-dinitroanilino)propyl]-5,12-dihydroxyicosa-6,8,10,14-tetraenamide |
| SMILES | CCCCCC=CC[C@@H](O)C=CC=CC=C[C@@H](O)CCCC(=O)NCCCNc1cc(F)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H41FN4O7/c1-2-3-4-5-6-9-14-23(35)15-10-7-8-11-16-24(36)17-12-18-29(37)32-20-13-19-31-26-21-25(30)27(33(38)39)22-28(26)34(40)41/h6-11,15-16,21-24,31,35-36H,2-5,12-14,17-20H2,1H3,(H,32,37)/t23-,24-/m1/s1 |
| InChIKey | OLQQKJDBJMBTGB-DNQXCXABSA-N |
| XLogP | 5.65 |
| TPSA | 167.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.67 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|