C20H37NO3 — CID 100925297
(9Z,11E)-13-hydroxy-N-(2-hydroxyethyl)octadeca-9,11-dienamide (PubChem CID 100925297) has the molecular formula C20H37NO3 and a molecular weight of 339.52 g/mol. Its IUPAC name is (9Z,11E)-13-hydroxy-N-(2-hydroxyethyl)octadeca-9,11-dienamide.
| Compound Name | (9Z,11E)-13-hydroxy-N-(2-hydroxyethyl)octadeca-9,11-dienamide |
|---|---|
| PubChem CID | 100925297 |
| Molecular Formula | C20H37NO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | (9Z,11E)-13-hydroxy-N-(2-hydroxyethyl)octadeca-9,11-dienamide |
| SMILES | CCCCCC(O)/C=C/C=C\CCCCCCCC(=O)NCCO |
| InChI | InChI=1S/C20H37NO3/c1-2-3-11-14-19(23)15-12-9-7-5-4-6-8-10-13-16-20(24)21-17-18-22/h7,9,12,15,19,22-23H,2-6,8,10-11,13-14,16-18H2,1H3,(H,21,24)/b9-7-,15-12+ |
| InChIKey | GBQSRUAXKWJYGA-BSZOFBHHSA-N |
| XLogP | 3.88 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|