C24H41FO5Si — CID 54162479
7-[(1R,2R)-2-[4-(fluoromethyl)-4-trimethylsilyloxyoct-1-enyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid (PubChem CID 54162479) has the molecular formula C24H41FO5Si and a molecular weight of 456.67 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[4-(fluoromethyl)-4-trimethylsilyloxyoct-1-enyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-[4-(fluoromethyl)-4-trimethylsilyloxyoct-1-enyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid |
|---|---|
| PubChem CID | 54162479 |
| Molecular Formula | C24H41FO5Si |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | 7-[(1R,2R)-2-[4-(fluoromethyl)-4-trimethylsilyloxyoct-1-enyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid |
| SMILES | CCCCC(CF)(CC=C[C@H]1CCC(=O)[C@@H]1CC=CCCC(O)C(=O)O)O[Si](C)(C)C |
| InChI | InChI=1S/C24H41FO5Si/c1-5-6-16-24(18-25,30-31(2,3)4)17-10-11-19-14-15-21(26)20(19)12-8-7-9-13-22(27)23(28)29/h7-8,10-11,19-20,22,27H,5-6,9,12-18H2,1-4H3,(H,28,29)/t19-,20+,22?,24?/m0/s1 |
| InChIKey | OPKCGOKPSRHMHM-MICDNJKTSA-N |
| XLogP | 5.45 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|