C18H18N4O5S — CID 54165404
dimethylamino 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-6-thiophen-2-ylbenzoate (PubChem CID 54165404) has the molecular formula C18H18N4O5S and a molecular weight of 402.43 g/mol. Its IUPAC name is dimethylamino 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-6-thiophen-2-ylbenzoate.
| Compound Name | dimethylamino 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-6-thiophen-2-ylbenzoate |
|---|---|
| PubChem CID | 54165404 |
| Molecular Formula | C18H18N4O5S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | dimethylamino 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-6-thiophen-2-ylbenzoate |
| SMILES | COc1nc(OC)nc(Oc2cccc(-c3cccs3)c2C(=O)ON(C)C)n1 |
| InChI | InChI=1S/C18H18N4O5S/c1-22(2)27-15(23)14-11(13-9-6-10-28-13)7-5-8-12(14)26-18-20-16(24-3)19-17(21-18)25-4/h5-10H,1-4H3 |
| InChIKey | ORHQMGCASOTEFZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 95.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|