C8H19NO2S — CID 54166534
2-(2,2-diethoxyethylsulfanyl)ethanamine (PubChem CID 54166534) has the molecular formula C8H19NO2S and a molecular weight of 193.31 g/mol. Its IUPAC name is 2-(2,2-diethoxyethylsulfanyl)ethanamine.
| Compound Name | 2-(2,2-diethoxyethylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 54166534 |
| Molecular Formula | C8H19NO2S |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-(2,2-diethoxyethylsulfanyl)ethanamine |
| SMILES | CCOC(CSCCN)OCC |
| InChI | InChI=1S/C8H19NO2S/c1-3-10-8(11-4-2)7-12-6-5-9/h8H,3-7,9H2,1-2H3 |
| InChIKey | OSAMXASRTQAMLM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|