C7H12NO8P — CID 54167976
(4S)-5-[acetyloxy(hydroxy)phosphoryl]oxy-4-amino-5-oxopentanoic acid (PubChem CID 54167976) has the molecular formula C7H12NO8P and a molecular weight of 269.15 g/mol. Its IUPAC name is (4S)-5-[acetyloxy(hydroxy)phosphoryl]oxy-4-amino-5-oxopentanoic acid.
| Compound Name | (4S)-5-[acetyloxy(hydroxy)phosphoryl]oxy-4-amino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 54167976 |
| Molecular Formula | C7H12NO8P |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | (4S)-5-[acetyloxy(hydroxy)phosphoryl]oxy-4-amino-5-oxopentanoic acid |
| SMILES | CC(=O)OP(=O)(O)OC(=O)[C@@H](N)CCC(=O)O |
| InChI | InChI=1S/C7H12NO8P/c1-4(9)15-17(13,14)16-7(12)5(8)2-3-6(10)11/h5H,2-3,8H2,1H3,(H,10,11)(H,13,14)/t5-/m0/s1 |
| InChIKey | OSZGKRJEGNNKNP-YFKPBYRVSA-N |
| XLogP | -0.61 |
| TPSA | 153.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|