(2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid

C10H20O4 — CID 54168213

IUPAC(2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid
SMILESCC[C@H]([C@@H](O)[C@H](C)C(=O)O)[C@H](O)CC
InChIInChI=1S/C10H20O4/c1-4-7(8(11)5-2)9(12)6(3)10(13)14/h6-9,11-12H,4-5H2,1-3H3,(H,13,14)/t6-,7-,8+,9-/m0/s1
InChIKeyOTDLOPJLCANORN-MAUMQABQSA-N
MW204.27 g/mol
LogP0.87
Rot. Bonds6

About (2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid

(2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid (PubChem CID 54168213) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is (2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid.

Molecular Properties

Compound Name(2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid
PubChem CID54168213
Molecular FormulaC10H20O4
Molecular Weight204.27 g/mol
Exact Mass204.14
IUPAC Name(2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid
SMILESCC[C@H]([C@@H](O)[C@H](C)C(=O)O)[C@H](O)CC
InChIInChI=1S/C10H20O4/c1-4-7(8(11)5-2)9(12)6(3)10(13)14/h6-9,11-12H,4-5H2,1-3H3,(H,13,14)/t6-,7-,8+,9-/m0/s1
InChIKeyOTDLOPJLCANORN-MAUMQABQSA-N
XLogP0.87
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.27
LogP ≤ 50.87
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid?
The IUPAC name of (2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid (CID 54168213) is (2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid.
What is the SMILES notation for (2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid?
The canonical SMILES for (2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid is CC[C@H]([C@@H](O)[C@H](C)C(=O)O)[C@H](O)CC.
What is the InChIKey of (2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid?
The InChIKey is OTDLOPJLCANORN-MAUMQABQSA-N. The full InChI is InChI=1S/C10H20O4/c1-4-7(8(11)5-2)9(12)6(3)10(13)14/h6-9,11-12H,4-5H2,1-3H3,(H,13,14)/t6-,7-,8+,9-/m0/s1.
What are the key properties of (2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid?
(2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid has a molecular weight of 204.27 g/mol, XLogP of 0.87, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid is sourced from PubChem (CID 54168213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).