C10H20O4 — CID 54168213
(2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid (PubChem CID 54168213) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is (2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid.
| Compound Name | (2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid |
|---|---|
| PubChem CID | 54168213 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | (2S,3R,4S,5R)-4-ethyl-3,5-dihydroxy-2-methylheptanoic acid |
| SMILES | CC[C@H]([C@@H](O)[C@H](C)C(=O)O)[C@H](O)CC |
| InChI | InChI=1S/C10H20O4/c1-4-7(8(11)5-2)9(12)6(3)10(13)14/h6-9,11-12H,4-5H2,1-3H3,(H,13,14)/t6-,7-,8+,9-/m0/s1 |
| InChIKey | OTDLOPJLCANORN-MAUMQABQSA-N |
| XLogP | 0.87 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |