C11H24O2 — CID 86084347
3,4-diethylheptane-2,5-diol (PubChem CID 86084347) has the molecular formula C11H24O2 and a molecular weight of 188.31 g/mol. Its IUPAC name is 3,4-diethylheptane-2,5-diol.
| Compound Name | 3,4-diethylheptane-2,5-diol |
|---|---|
| PubChem CID | 86084347 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | 3,4-diethylheptane-2,5-diol |
| SMILES | CCC(O)C(CC)C(CC)C(C)O |
| InChI | InChI=1S/C11H24O2/c1-5-9(8(4)12)10(6-2)11(13)7-3/h8-13H,5-7H2,1-4H3 |
| InChIKey | RSFLYOJIODWMOQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |