About 3,4-diethylheptane-2,5-diol
3,4-diethylheptane-2,5-diol (PubChem CID 86084347) has the molecular formula C11H24O2
and a molecular weight of 188.31 g/mol. Its IUPAC name is 3,4-diethylheptane-2,5-diol.
Molecular Properties
| Compound Name | 3,4-diethylheptane-2,5-diol |
| PubChem CID | 86084347 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | 3,4-diethylheptane-2,5-diol |
| SMILES | CCC(O)C(CC)C(CC)C(C)O |
| InChI | InChI=1S/C11H24O2/c1-5-9(8(4)12)10(6-2)11(13)7-3/h8-13H,5-7H2,1-4H3 |
| InChIKey | RSFLYOJIODWMOQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-diethylheptane-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethylheptane-2,5-diol?
The IUPAC name of 3,4-diethylheptane-2,5-diol (CID 86084347) is 3,4-diethylheptane-2,5-diol.
What is the SMILES notation for 3,4-diethylheptane-2,5-diol?
The canonical SMILES for 3,4-diethylheptane-2,5-diol is CCC(O)C(CC)C(CC)C(C)O.
What is the InChIKey of 3,4-diethylheptane-2,5-diol?
The InChIKey is RSFLYOJIODWMOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O2/c1-5-9(8(4)12)10(6-2)11(13)7-3/h8-13H,5-7H2,1-4H3.
What are the key properties of 3,4-diethylheptane-2,5-diol?
3,4-diethylheptane-2,5-diol has a molecular weight of 188.31 g/mol, XLogP of 2.19, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethylheptane-2,5-diol is sourced from PubChem (CID 86084347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).