C11H20O7 — CID 90364715
3,4-dihydroxy-6-(2-hydroxypropyl)-2-methylheptanedioic acid (PubChem CID 90364715) has the molecular formula C11H20O7 and a molecular weight of 264.27 g/mol. Its IUPAC name is 3,4-dihydroxy-6-(2-hydroxypropyl)-2-methylheptanedioic acid.
| Compound Name | 3,4-dihydroxy-6-(2-hydroxypropyl)-2-methylheptanedioic acid |
|---|---|
| PubChem CID | 90364715 |
| Molecular Formula | C11H20O7 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 3,4-dihydroxy-6-(2-hydroxypropyl)-2-methylheptanedioic acid |
| SMILES | CC(O)CC(CC(O)C(O)C(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H20O7/c1-5(12)3-7(11(17)18)4-8(13)9(14)6(2)10(15)16/h5-9,12-14H,3-4H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | HBYPMVOUUKWLGF-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |