C26H24FN5O3 — CID 54170243
4-(4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbonyl)-N-(2-hydroxyphenyl)benzamide (PubChem CID 54170243) has the molecular formula C26H24FN5O3 and a molecular weight of 473.51 g/mol. Its IUPAC name is 4-(4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbonyl)-N-(2-hydroxyphenyl)benzamide.
| Compound Name | 4-(4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbonyl)-N-(2-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 54170243 |
| Molecular Formula | C26H24FN5O3 |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 4-(4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbonyl)-N-(2-hydroxyphenyl)benzamide |
| SMILES | NC1=NC2(CCN(C(=O)c3ccc(C(=O)Nc4ccccc4O)cc3)CC2)Nc2cccc(F)c21 |
| InChI | InChI=1S/C26H24FN5O3/c27-18-4-3-6-20-22(18)23(28)31-26(30-20)12-14-32(15-13-26)25(35)17-10-8-16(9-11-17)24(34)29-19-5-1-2-7-21(19)33/h1-11,30,33H,12-15H2,(H2,28,31)(H,29,34) |
| InChIKey | OUMYDVQUVDWLQO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|