C21H24ClFN4O2S — CID 67569240
2-phenylsulfanylethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate;hydrochloride (PubChem CID 67569240) has the molecular formula C21H24ClFN4O2S and a molecular weight of 450.97 g/mol. Its IUPAC name is 2-phenylsulfanylethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate;hydrochloride.
| Compound Name | 2-phenylsulfanylethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 67569240 |
| Molecular Formula | C21H24ClFN4O2S |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 2-phenylsulfanylethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate;hydrochloride |
| SMILES | Cl.NC1=NC2(CCN(C(=O)OCCSc3ccccc3)CC2)Nc2cccc(F)c21 |
| InChI | InChI=1S/C21H23FN4O2S.ClH/c22-16-7-4-8-17-18(16)19(23)25-21(24-17)9-11-26(12-10-21)20(27)28-13-14-29-15-5-2-1-3-6-15;/h1-8,24H,9-14H2,(H2,23,25);1H |
| InChIKey | QXCZKYWJIBYSIY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|