About S-ethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbothioate;hydrochloride
S-ethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbothioate;hydrochloride (PubChem CID 142634783) has the molecular formula C15H20ClFN4OS
and a molecular weight of 358.87 g/mol. Its IUPAC name is S-ethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbothioate;hydrochloride.
Molecular Properties
| Compound Name | S-ethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbothioate;hydrochloride |
| PubChem CID | 142634783 |
| Molecular Formula | C15H20ClFN4OS |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | S-ethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbothioate;hydrochloride |
| SMILES | CCSC(=O)N1CCC2(CC1)N=C(N)c1c(F)cccc1N2.Cl |
| InChI | InChI=1S/C15H19FN4OS.ClH/c1-2-22-14(21)20-8-6-15(7-9-20)18-11-5-3-4-10(16)12(11)13(17)19-15;/h3-5,18H,2,6-9H2,1H3,(H2,17,19);1H |
| InChIKey | NWRUPSNGPWZMRW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbothioate;hydrochloride?
The IUPAC name of S-ethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbothioate;hydrochloride (CID 142634783) is S-ethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbothioate;hydrochloride.
What is the SMILES notation for S-ethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbothioate;hydrochloride?
The canonical SMILES for S-ethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbothioate;hydrochloride is CCSC(=O)N1CCC2(CC1)N=C(N)c1c(F)cccc1N2.Cl.
What is the InChIKey of S-ethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbothioate;hydrochloride?
The InChIKey is NWRUPSNGPWZMRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FN4OS.ClH/c1-2-22-14(21)20-8-6-15(7-9-20)18-11-5-3-4-10(16)12(11)13(17)19-15;/h3-5,18H,2,6-9H2,1H3,(H2,17,19);1H.
What are the key properties of S-ethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbothioate;hydrochloride?
S-ethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbothioate;hydrochloride has a molecular weight of 358.87 g/mol, XLogP of 3.04, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbothioate;hydrochloride is sourced from PubChem (CID 142634783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).