C15H20ClFN4OS — CID 142634783
S-ethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbothioate;hydrochloride (PubChem CID 142634783) has the molecular formula C15H20ClFN4OS and a molecular weight of 358.87 g/mol. Its IUPAC name is S-ethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbothioate;hydrochloride.
| Compound Name | S-ethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbothioate;hydrochloride |
|---|---|
| PubChem CID | 142634783 |
| Molecular Formula | C15H20ClFN4OS |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | S-ethyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carbothioate;hydrochloride |
| SMILES | CCSC(=O)N1CCC2(CC1)N=C(N)c1c(F)cccc1N2.Cl |
| InChI | InChI=1S/C15H19FN4OS.ClH/c1-2-22-14(21)20-8-6-15(7-9-20)18-11-5-3-4-10(16)12(11)13(17)19-15;/h3-5,18H,2,6-9H2,1H3,(H2,17,19);1H |
| InChIKey | NWRUPSNGPWZMRW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|