C17H23FN4O4S — CID 21192853
3-methylsulfonylpropyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate (PubChem CID 21192853) has the molecular formula C17H23FN4O4S and a molecular weight of 398.46 g/mol. Its IUPAC name is 3-methylsulfonylpropyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate.
| Compound Name | 3-methylsulfonylpropyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 21192853 |
| Molecular Formula | C17H23FN4O4S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 3-methylsulfonylpropyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate |
| SMILES | CS(=O)(=O)CCCOC(=O)N1CCC2(CC1)N=C(N)c1c(F)cccc1N2 |
| InChI | InChI=1S/C17H23FN4O4S/c1-27(24,25)11-3-10-26-16(23)22-8-6-17(7-9-22)20-13-5-2-4-12(18)14(13)15(19)21-17/h2,4-5,20H,3,6-11H2,1H3,(H2,19,21) |
| InChIKey | FKLNOZAFNUTMHN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|