About but-3-ynyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate
but-3-ynyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate (PubChem CID 21192779) has the molecular formula C17H19FN4O2
and a molecular weight of 330.36 g/mol. Its IUPAC name is but-3-ynyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate.
Molecular Properties
| Compound Name | but-3-ynyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate |
| PubChem CID | 21192779 |
| Molecular Formula | C17H19FN4O2 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | but-3-ynyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate |
| SMILES | C#CCCOC(=O)N1CCC2(CC1)N=C(N)c1c(F)cccc1N2 |
| InChI | InChI=1S/C17H19FN4O2/c1-2-3-11-24-16(23)22-9-7-17(8-10-22)20-13-6-4-5-12(18)14(13)15(19)21-17/h1,4-6,20H,3,7-11H2,(H2,19,21) |
| InChIKey | LFKNZHLSXFNSFY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-3-ynyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-ynyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate?
The IUPAC name of but-3-ynyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate (CID 21192779) is but-3-ynyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate.
What is the SMILES notation for but-3-ynyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate?
The canonical SMILES for but-3-ynyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate is C#CCCOC(=O)N1CCC2(CC1)N=C(N)c1c(F)cccc1N2.
What is the InChIKey of but-3-ynyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate?
The InChIKey is LFKNZHLSXFNSFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19FN4O2/c1-2-3-11-24-16(23)22-9-7-17(8-10-22)20-13-6-4-5-12(18)14(13)15(19)21-17/h1,4-6,20H,3,7-11H2,(H2,19,21).
What are the key properties of but-3-ynyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate?
but-3-ynyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate has a molecular weight of 330.36 g/mol, XLogP of 1.91, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-ynyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate is sourced from PubChem (CID 21192779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).