C15H19NO4 — CID 5417578
(Z)-2-hydroxy-N-(4-methoxyphenyl)-5,5-dimethyl-4-oxohex-2-enamide (PubChem CID 5417578) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is (Z)-2-hydroxy-N-(4-methoxyphenyl)-5,5-dimethyl-4-oxohex-2-enamide.
| Compound Name | (Z)-2-hydroxy-N-(4-methoxyphenyl)-5,5-dimethyl-4-oxohex-2-enamide |
|---|---|
| PubChem CID | 5417578 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | (Z)-2-hydroxy-N-(4-methoxyphenyl)-5,5-dimethyl-4-oxohex-2-enamide |
| SMILES | COc1ccc(NC(=O)/C(O)=C/C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H19NO4/c1-15(2,3)13(18)9-12(17)14(19)16-10-5-7-11(20-4)8-6-10/h5-9,17H,1-4H3,(H,16,19)/b12-9- |
| InChIKey | XFNSJEIYDZJKGI-XFXZXTDPSA-N |
| XLogP | 2.69 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|