C15H14FN5O4 — CID 54175848
N-[[3-[3-fluoro-4-(4-formyltriazol-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 54175848) has the molecular formula C15H14FN5O4 and a molecular weight of 347.31 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-(4-formyltriazol-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[3-fluoro-4-(4-formyltriazol-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 54175848 |
| Molecular Formula | C15H14FN5O4 |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N-[[3-[3-fluoro-4-(4-formyltriazol-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(-n3cc(C=O)nn3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H14FN5O4/c1-9(23)17-5-12-7-20(15(24)25-12)11-2-3-14(13(16)4-11)21-6-10(8-22)18-19-21/h2-4,6,8,12H,5,7H2,1H3,(H,17,23) |
| InChIKey | OYHRFPCSCUKHFQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|