C20H22F2N6O4 — CID 76560990
N-[[3-[3-fluoro-4-[3-fluoro-4-(4-formyltriazol-1-yl)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 76560990) has the molecular formula C20H22F2N6O4 and a molecular weight of 448.43 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-[3-fluoro-4-(4-formyltriazol-1-yl)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[3-fluoro-4-[3-fluoro-4-(4-formyltriazol-1-yl)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 76560990 |
| Molecular Formula | C20H22F2N6O4 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | N-[[3-[3-fluoro-4-[3-fluoro-4-(4-formyltriazol-1-yl)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CCC(n4cc(C=O)nn4)C(F)C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C20H22F2N6O4/c1-12(30)23-7-15-9-27(20(31)32-15)14-2-3-18(16(21)6-14)26-5-4-19(17(22)10-26)28-8-13(11-29)24-25-28/h2-3,6,8,11,15,17,19H,4-5,7,9-10H2,1H3,(H,23,30) |
| InChIKey | HKAFGTMMUGOXPV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|