C9H9NO2 — CID 54179855
3,4-dimethyl-2-nitrosobenzaldehyde (PubChem CID 54179855) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 3,4-dimethyl-2-nitrosobenzaldehyde.
| Compound Name | 3,4-dimethyl-2-nitrosobenzaldehyde |
|---|---|
| PubChem CID | 54179855 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 3,4-dimethyl-2-nitrosobenzaldehyde |
| SMILES | Cc1ccc(C=O)c(N=O)c1C |
| InChI | InChI=1S/C9H9NO2/c1-6-3-4-8(5-11)9(10-12)7(6)2/h3-5H,1-2H3 |
| InChIKey | PBAULYFTPLFZFE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|