C8H8BrNO — CID 174861942
1-bromo-3,4-dimethyl-2-nitrosobenzene (PubChem CID 174861942) has the molecular formula C8H8BrNO and a molecular weight of 214.06 g/mol. Its IUPAC name is 1-bromo-3,4-dimethyl-2-nitrosobenzene.
| Compound Name | 1-bromo-3,4-dimethyl-2-nitrosobenzene |
|---|---|
| PubChem CID | 174861942 |
| Molecular Formula | C8H8BrNO |
| Molecular Weight | 214.06 g/mol |
| Exact Mass | 212.98 |
| IUPAC Name | 1-bromo-3,4-dimethyl-2-nitrosobenzene |
| SMILES | Cc1ccc(Br)c(N=O)c1C |
| InChI | InChI=1S/C8H8BrNO/c1-5-3-4-7(9)8(10-11)6(5)2/h3-4H,1-2H3 |
| InChIKey | HEDZZCHOADJMRY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.06 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |