C24H24Br3O4P — CID 70632464
tris(6-bromo-2,3-dimethylphenyl) phosphate (PubChem CID 70632464) has the molecular formula C24H24Br3O4P and a molecular weight of 647.14 g/mol. Its IUPAC name is tris(6-bromo-2,3-dimethylphenyl) phosphate.
| Compound Name | tris(6-bromo-2,3-dimethylphenyl) phosphate |
|---|---|
| PubChem CID | 70632464 |
| Molecular Formula | C24H24Br3O4P |
| Molecular Weight | 647.14 g/mol |
| Exact Mass | 643.90 |
| IUPAC Name | tris(6-bromo-2,3-dimethylphenyl) phosphate |
| SMILES | Cc1ccc(Br)c(OP(=O)(Oc2c(Br)ccc(C)c2C)Oc2c(Br)ccc(C)c2C)c1C |
| InChI | InChI=1S/C24H24Br3O4P/c1-13-7-10-19(25)22(16(13)4)29-32(28,30-23-17(5)14(2)8-11-20(23)26)31-24-18(6)15(3)9-12-21(24)27/h7-12H,1-6H3 |
| InChIKey | QHURYPJLLKOZSP-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.14 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|