C16H10Br2O2 — CID 158328255
1,5-dibromo-4,8-dimethylanthracene-9,10-dione (PubChem CID 158328255) has the molecular formula C16H10Br2O2 and a molecular weight of 394.06 g/mol. Its IUPAC name is 1,5-dibromo-4,8-dimethylanthracene-9,10-dione.
| Compound Name | 1,5-dibromo-4,8-dimethylanthracene-9,10-dione |
|---|---|
| PubChem CID | 158328255 |
| Molecular Formula | C16H10Br2O2 |
| Molecular Weight | 394.06 g/mol |
| Exact Mass | 391.90 |
| IUPAC Name | 1,5-dibromo-4,8-dimethylanthracene-9,10-dione |
| SMILES | Cc1ccc(Br)c2c1C(=O)c1c(Br)ccc(C)c1C2=O |
| InChI | InChI=1S/C16H10Br2O2/c1-7-3-5-9(17)13-11(7)15(19)14-10(18)6-4-8(2)12(14)16(13)20/h3-6H,1-2H3 |
| InChIKey | AEJWHEHNPJLLHW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.06 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|