C7H6ClF5O2 — CID 54181035
2-chloro-1-ethoxy-4,4,5,5,5-pentafluoropent-1-en-3-one (PubChem CID 54181035) has the molecular formula C7H6ClF5O2 and a molecular weight of 252.57 g/mol. Its IUPAC name is 2-chloro-1-ethoxy-4,4,5,5,5-pentafluoropent-1-en-3-one.
| Compound Name | 2-chloro-1-ethoxy-4,4,5,5,5-pentafluoropent-1-en-3-one |
|---|---|
| PubChem CID | 54181035 |
| Molecular Formula | C7H6ClF5O2 |
| Molecular Weight | 252.57 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 2-chloro-1-ethoxy-4,4,5,5,5-pentafluoropent-1-en-3-one |
| SMILES | CCOC=C(Cl)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H6ClF5O2/c1-2-15-3-4(8)5(14)6(9,10)7(11,12)13/h3H,2H2,1H3 |
| InChIKey | PBUNECOFOPSZNA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|