C8H7ClF6O2 — CID 23236621
(Z)-2-chloro-1-ethoxy-5,5,5-trifluoro-4-(trifluoromethyl)pent-1-en-3-one (PubChem CID 23236621) has the molecular formula C8H7ClF6O2 and a molecular weight of 284.58 g/mol. Its IUPAC name is (Z)-2-chloro-1-ethoxy-5,5,5-trifluoro-4-(trifluoromethyl)pent-1-en-3-one.
| Compound Name | (Z)-2-chloro-1-ethoxy-5,5,5-trifluoro-4-(trifluoromethyl)pent-1-en-3-one |
|---|---|
| PubChem CID | 23236621 |
| Molecular Formula | C8H7ClF6O2 |
| Molecular Weight | 284.58 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | (Z)-2-chloro-1-ethoxy-5,5,5-trifluoro-4-(trifluoromethyl)pent-1-en-3-one |
| SMILES | CCO/C=C(\Cl)C(=O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H7ClF6O2/c1-2-17-3-4(9)5(16)6(7(10,11)12)8(13,14)15/h3,6H,2H2,1H3/b4-3- |
| InChIKey | GNPXDUBEGIZFCH-ARJAWSKDSA-N |
| XLogP | 3.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|