C8H6ClF5O3 — CID 137441606
(3E)-1-chloro-3-(ethoxymethylidene)-1,1,5,5,5-pentafluoropentane-2,4-dione (PubChem CID 137441606) has the molecular formula C8H6ClF5O3 and a molecular weight of 280.58 g/mol. Its IUPAC name is (3E)-1-chloro-3-(ethoxymethylidene)-1,1,5,5,5-pentafluoropentane-2,4-dione.
| Compound Name | (3E)-1-chloro-3-(ethoxymethylidene)-1,1,5,5,5-pentafluoropentane-2,4-dione |
|---|---|
| PubChem CID | 137441606 |
| Molecular Formula | C8H6ClF5O3 |
| Molecular Weight | 280.58 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | (3E)-1-chloro-3-(ethoxymethylidene)-1,1,5,5,5-pentafluoropentane-2,4-dione |
| SMILES | CCO/C=C(\C(=O)C(F)(F)F)C(=O)C(F)(F)Cl |
| InChI | InChI=1S/C8H6ClF5O3/c1-2-17-3-4(5(15)7(9,10)11)6(16)8(12,13)14/h3H,2H2,1H3/b4-3- |
| InChIKey | HZQYIPCQYCENQV-ARJAWSKDSA-N |
| XLogP | 2.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.58 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|