C8H9ClF2O3 — CID 19074090
(3E)-1-chloro-3-(ethoxymethylidene)-1,1-difluoropentane-2,4-dione (PubChem CID 19074090) has the molecular formula C8H9ClF2O3 and a molecular weight of 226.61 g/mol. Its IUPAC name is (3E)-1-chloro-3-(ethoxymethylidene)-1,1-difluoropentane-2,4-dione.
| Compound Name | (3E)-1-chloro-3-(ethoxymethylidene)-1,1-difluoropentane-2,4-dione |
|---|---|
| PubChem CID | 19074090 |
| Molecular Formula | C8H9ClF2O3 |
| Molecular Weight | 226.61 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | (3E)-1-chloro-3-(ethoxymethylidene)-1,1-difluoropentane-2,4-dione |
| SMILES | CCO/C=C(\C(C)=O)C(=O)C(F)(F)Cl |
| InChI | InChI=1S/C8H9ClF2O3/c1-3-14-4-6(5(2)12)7(13)8(9,10)11/h4H,3H2,1-2H3/b6-4+ |
| InChIKey | OXOAXTGYKYPNJM-GQCTYLIASA-N |
| XLogP | 1.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.61 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|