C35H49NO3 — CID 54182255
2-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-3,1-benzoxazin-4-one (PubChem CID 54182255) has the molecular formula C35H49NO3 and a molecular weight of 531.78 g/mol. Its IUPAC name is 2-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-3,1-benzoxazin-4-one.
| Compound Name | 2-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 54182255 |
| Molecular Formula | C35H49NO3 |
| Molecular Weight | 531.78 g/mol |
| Exact Mass | 531.37 |
| IUPAC Name | 2-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-3,1-benzoxazin-4-one |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3CC=C4CC(Oc5nc6ccccc6c(=O)o5)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C35H49NO3/c1-22(2)9-8-10-23(3)28-15-16-29-26-14-13-24-21-25(17-19-34(24,4)30(26)18-20-35(28,29)5)38-33-36-31-12-7-6-11-27(31)32(37)39-33/h6-7,11-13,22-23,25-26,28-30H,8-10,14-21H2,1-5H3/t23-,25?,26?,28-,29?,30?,34+,35-/m1/s1 |
| InChIKey | PCPZBFSQFOFNNQ-ZSDMZYJSSA-N |
| XLogP | 8.98 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.78 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|