C23H29N3O3 — CID 54184682
tert-butyl N-[4-[5-[benzyl(formyl)amino]-3-pyridinyl]but-3-enyl]-N-methylcarbamate (PubChem CID 54184682) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is tert-butyl N-[4-[5-[benzyl(formyl)amino]-3-pyridinyl]but-3-enyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[5-[benzyl(formyl)amino]-3-pyridinyl]but-3-enyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 54184682 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | tert-butyl N-[4-[5-[benzyl(formyl)amino]-3-pyridinyl]but-3-enyl]-N-methylcarbamate |
| SMILES | CN(CCC=Cc1cncc(N(C=O)Cc2ccccc2)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H29N3O3/c1-23(2,3)29-22(28)25(4)13-9-8-12-20-14-21(16-24-15-20)26(18-27)17-19-10-6-5-7-11-19/h5-8,10-12,14-16,18H,9,13,17H2,1-4H3 |
| InChIKey | PEGRAKQCKIHNBF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|