C22H26ClN3O3 — CID 54192486
tert-butyl (2S)-2-[[6-chloro-5-(2-pyridin-4-ylethenyl)-3-pyridinyl]oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 54192486) has the molecular formula C22H26ClN3O3 and a molecular weight of 415.92 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[6-chloro-5-(2-pyridin-4-ylethenyl)-3-pyridinyl]oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[6-chloro-5-(2-pyridin-4-ylethenyl)-3-pyridinyl]oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 54192486 |
| Molecular Formula | C22H26ClN3O3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | tert-butyl (2S)-2-[[6-chloro-5-(2-pyridin-4-ylethenyl)-3-pyridinyl]oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1COc1cnc(Cl)c(C=Cc2ccncc2)c1 |
| InChI | InChI=1S/C22H26ClN3O3/c1-22(2,3)29-21(27)26-12-4-5-18(26)15-28-19-13-17(20(23)25-14-19)7-6-16-8-10-24-11-9-16/h6-11,13-14,18H,4-5,12,15H2,1-3H3/t18-/m0/s1 |
| InChIKey | PJMLKFVLKIKXBC-SFHVURJKSA-N |
| XLogP | 5.08 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|