C18H21ClN4O3 — CID 22961821
tert-butyl (2S)-2-[(6-chloro-5-pyrimidin-5-yl-3-pyridinyl)oxymethyl]azetidine-1-carboxylate (PubChem CID 22961821) has the molecular formula C18H21ClN4O3 and a molecular weight of 376.84 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(6-chloro-5-pyrimidin-5-yl-3-pyridinyl)oxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(6-chloro-5-pyrimidin-5-yl-3-pyridinyl)oxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 22961821 |
| Molecular Formula | C18H21ClN4O3 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | tert-butyl (2S)-2-[(6-chloro-5-pyrimidin-5-yl-3-pyridinyl)oxymethyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]1COc1cnc(Cl)c(-c2cncnc2)c1 |
| InChI | InChI=1S/C18H21ClN4O3/c1-18(2,3)26-17(24)23-5-4-13(23)10-25-14-6-15(16(19)22-9-14)12-7-20-11-21-8-12/h6-9,11,13H,4-5,10H2,1-3H3/t13-/m0/s1 |
| InChIKey | PYTMUDAPRUMHKQ-ZDUSSCGKSA-N |
| XLogP | 3.58 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|