C5H6N2O3S2 — CID 54192745
[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid (PubChem CID 54192745) has the molecular formula C5H6N2O3S2 and a molecular weight of 206.25 g/mol. Its IUPAC name is [5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid.
| Compound Name | [5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid |
|---|---|
| PubChem CID | 54192745 |
| Molecular Formula | C5H6N2O3S2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 205.98 |
| IUPAC Name | [5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid |
| SMILES | COCc1nnc(SC(=O)O)s1 |
| InChI | InChI=1S/C5H6N2O3S2/c1-10-2-3-6-7-4(11-3)12-5(8)9/h2H2,1H3,(H,8,9) |
| InChIKey | XPTWTZHQFIGFDJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|