[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid

C5H6N2O3S2 — CID 54192745

IUPAC[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid
SMILESCOCc1nnc(SC(=O)O)s1
InChIInChI=1S/C5H6N2O3S2/c1-10-2-3-6-7-4(11-3)12-5(8)9/h2H2,1H3,(H,8,9)
InChIKeyXPTWTZHQFIGFDJ-UHFFFAOYSA-N
MW206.25 g/mol
LogP1.45
Rot. Bonds3

About [5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid

[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid (PubChem CID 54192745) has the molecular formula C5H6N2O3S2 and a molecular weight of 206.25 g/mol. Its IUPAC name is [5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid.

Molecular Properties

Compound Name[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid
PubChem CID54192745
Molecular FormulaC5H6N2O3S2
Molecular Weight206.25 g/mol
Exact Mass205.98
IUPAC Name[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid
SMILESCOCc1nnc(SC(=O)O)s1
InChIInChI=1S/C5H6N2O3S2/c1-10-2-3-6-7-4(11-3)12-5(8)9/h2H2,1H3,(H,8,9)
InChIKeyXPTWTZHQFIGFDJ-UHFFFAOYSA-N
XLogP1.45
TPSA72.31 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.25
LogP ≤ 51.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thioester', 'substructure': 'N/A'}

Analyze [5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid?
The IUPAC name of [5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid (CID 54192745) is [5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid.
What is the SMILES notation for [5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid?
The canonical SMILES for [5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid is COCc1nnc(SC(=O)O)s1.
What is the InChIKey of [5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid?
The InChIKey is XPTWTZHQFIGFDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O3S2/c1-10-2-3-6-7-4(11-3)12-5(8)9/h2H2,1H3,(H,8,9).
What are the key properties of [5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid?
[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid has a molecular weight of 206.25 g/mol, XLogP of 1.45, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]sulfanylformic acid is sourced from PubChem (CID 54192745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).