C8H14N4O2S2 — CID 84561305
2-(2-aminoethylsulfanyl)-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 84561305) has the molecular formula C8H14N4O2S2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-(2-aminoethylsulfanyl)-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(2-aminoethylsulfanyl)-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 84561305 |
| Molecular Formula | C8H14N4O2S2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-(2-aminoethylsulfanyl)-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | COCc1nnc(NC(=O)CSCCN)s1 |
| InChI | InChI=1S/C8H14N4O2S2/c1-14-4-7-11-12-8(16-7)10-6(13)5-15-3-2-9/h2-5,9H2,1H3,(H,10,12,13) |
| InChIKey | MKWUHNGZJKVVJG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|