C10H14N4OS2 — CID 82531236
2-(3-cyanopropylsulfanyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 82531236) has the molecular formula C10H14N4OS2 and a molecular weight of 270.38 g/mol. Its IUPAC name is 2-(3-cyanopropylsulfanyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(3-cyanopropylsulfanyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 82531236 |
| Molecular Formula | C10H14N4OS2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2-(3-cyanopropylsulfanyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCc1nnc(NC(=O)CSCCCC#N)s1 |
| InChI | InChI=1S/C10H14N4OS2/c1-2-9-13-14-10(17-9)12-8(15)7-16-6-4-3-5-11/h2-4,6-7H2,1H3,(H,12,14,15) |
| InChIKey | JVSZQDVBIZYZFW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|