C10H14N4O3S2 — CID 82531604
2-(3-cyanopropylsulfonyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 82531604) has the molecular formula C10H14N4O3S2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-(3-cyanopropylsulfonyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(3-cyanopropylsulfonyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 82531604 |
| Molecular Formula | C10H14N4O3S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-(3-cyanopropylsulfonyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCc1nnc(NC(=O)CS(=O)(=O)CCCC#N)s1 |
| InChI | InChI=1S/C10H14N4O3S2/c1-2-9-13-14-10(18-9)12-8(15)7-19(16,17)6-4-3-5-11/h2-4,6-7H2,1H3,(H,12,14,15) |
| InChIKey | QWTBMIIQZVNNMM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|